C34H18O4S2 — CID 176643790
2-[[4-[5-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]thiophen-2-yl]phenyl]methylidene]indene-1,3-dione (PubChem CID 176643790) has the molecular formula C34H18O4S2 and a molecular weight of 554.65 g/mol. Its IUPAC name is 2-[[4-[5-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]thiophen-2-yl]phenyl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[4-[5-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]thiophen-2-yl]phenyl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 176643790 |
| Molecular Formula | C34H18O4S2 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | 2-[[4-[5-[5-[(1,3-dioxoinden-2-ylidene)methyl]thiophen-2-yl]thiophen-2-yl]phenyl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2ccc(-c3ccc(-c4ccc(C=C5C(=O)c6ccccc6C5=O)s4)s3)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C34H18O4S2/c35-31-22-5-1-2-6-23(22)32(36)26(31)17-19-9-11-20(12-10-19)28-15-16-30(40-28)29-14-13-21(39-29)18-27-33(37)24-7-3-4-8-25(24)34(27)38/h1-18H |
| InChIKey | HQRKIISWFWOXOZ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|