C56H36N2O4 — CID 20617859
2-[[4-(N-[4-[4-(N-[4-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]anilino)phenyl]phenyl]anilino)phenyl]methylidene]indene-1,3-dione (PubChem CID 20617859) has the molecular formula C56H36N2O4 and a molecular weight of 800.91 g/mol. Its IUPAC name is 2-[[4-(N-[4-[4-(N-[4-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]anilino)phenyl]phenyl]anilino)phenyl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[4-(N-[4-[4-(N-[4-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]anilino)phenyl]phenyl]anilino)phenyl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 20617859 |
| Molecular Formula | C56H36N2O4 |
| Molecular Weight | 800.91 g/mol |
| Exact Mass | 800.27 |
| IUPAC Name | 2-[[4-(N-[4-[4-(N-[4-[(1,3-dioxoinden-2-ylidene)methyl]phenyl]anilino)phenyl]phenyl]anilino)phenyl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2ccc(N(c3ccccc3)c3ccc(-c4ccc(N(c5ccccc5)c5ccc(C=C6C(=O)c7ccccc7C6=O)cc5)cc4)cc3)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C56H36N2O4/c59-53-47-15-7-8-16-48(47)54(60)51(53)35-37-19-27-43(28-20-37)57(41-11-3-1-4-12-41)45-31-23-39(24-32-45)40-25-33-46(34-26-40)58(42-13-5-2-6-14-42)44-29-21-38(22-30-44)36-52-55(61)49-17-9-10-18-50(49)56(52)62/h1-36H |
| InChIKey | XQQSMRJBSTXGBE-UHFFFAOYSA-N |
| XLogP | 13.22 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.91 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|