C52H36N2O4 — CID 59994776
2-[[4-[N-benzyl-4-[N-benzyl-4-[(1,3-dioxoinden-2-ylidene)methyl]anilino]anilino]phenyl]methylidene]indene-1,3-dione (PubChem CID 59994776) has the molecular formula C52H36N2O4 and a molecular weight of 752.87 g/mol. Its IUPAC name is 2-[[4-[N-benzyl-4-[N-benzyl-4-[(1,3-dioxoinden-2-ylidene)methyl]anilino]anilino]phenyl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[4-[N-benzyl-4-[N-benzyl-4-[(1,3-dioxoinden-2-ylidene)methyl]anilino]anilino]phenyl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 59994776 |
| Molecular Formula | C52H36N2O4 |
| Molecular Weight | 752.87 g/mol |
| Exact Mass | 752.27 |
| IUPAC Name | 2-[[4-[N-benzyl-4-[N-benzyl-4-[(1,3-dioxoinden-2-ylidene)methyl]anilino]anilino]phenyl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2ccc(N(Cc3ccccc3)c3ccc(N(Cc4ccccc4)c4ccc(C=C5C(=O)c6ccccc6C5=O)cc4)cc3)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C52H36N2O4/c55-49-43-15-7-8-16-44(43)50(56)47(49)31-35-19-23-39(24-20-35)53(33-37-11-3-1-4-12-37)41-27-29-42(30-28-41)54(34-38-13-5-2-6-14-38)40-25-21-36(22-26-40)32-48-51(57)45-17-9-10-18-46(45)52(48)58/h1-32H,33-34H2 |
| InChIKey | ASUDSXVJHWWSOX-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.87 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|