C19H17NO4S — CID 141001550
5-(N-benzylanilino)-2-hydroxybenzenesulfonic acid (PubChem CID 141001550) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is 5-(N-benzylanilino)-2-hydroxybenzenesulfonic acid.
| Compound Name | 5-(N-benzylanilino)-2-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 141001550 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 5-(N-benzylanilino)-2-hydroxybenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(N(Cc2ccccc2)c2ccccc2)ccc1O |
| InChI | InChI=1S/C19H17NO4S/c21-18-12-11-17(13-19(18)25(22,23)24)20(16-9-5-2-6-10-16)14-15-7-3-1-4-8-15/h1-13,21H,14H2,(H,22,23,24) |
| InChIKey | KJBUSBOYSMFHQD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|