C32H30N4 — CID 129240505
4-N-[[3-[(N-(4-aminophenyl)anilino)methyl]phenyl]methyl]-4-N-phenylbenzene-1,4-diamine (PubChem CID 129240505) has the molecular formula C32H30N4 and a molecular weight of 470.62 g/mol. Its IUPAC name is 4-N-[[3-[(N-(4-aminophenyl)anilino)methyl]phenyl]methyl]-4-N-phenylbenzene-1,4-diamine.
| Compound Name | 4-N-[[3-[(N-(4-aminophenyl)anilino)methyl]phenyl]methyl]-4-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 129240505 |
| Molecular Formula | C32H30N4 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 4-N-[[3-[(N-(4-aminophenyl)anilino)methyl]phenyl]methyl]-4-N-phenylbenzene-1,4-diamine |
| SMILES | Nc1ccc(N(Cc2cccc(CN(c3ccccc3)c3ccc(N)cc3)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H30N4/c33-27-14-18-31(19-15-27)35(29-10-3-1-4-11-29)23-25-8-7-9-26(22-25)24-36(30-12-5-2-6-13-30)32-20-16-28(34)17-21-32/h1-22H,23-24,33-34H2 |
| InChIKey | ZJGIUFAKIPKIIO-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|