About aniline;N-benzyl-N-methylaniline
aniline;N-benzyl-N-methylaniline (PubChem CID 163577424) has the molecular formula C20H22N2
and a molecular weight of 290.41 g/mol. Its IUPAC name is aniline;N-benzyl-N-methylaniline.
Molecular Properties
| Compound Name | aniline;N-benzyl-N-methylaniline |
| PubChem CID | 163577424 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | aniline;N-benzyl-N-methylaniline |
| SMILES | CN(Cc1ccccc1)c1ccccc1.Nc1ccccc1 |
| InChI | InChI=1S/C14H15N.C6H7N/c1-15(14-10-6-3-7-11-14)12-13-8-4-2-5-9-13;7-6-4-2-1-3-5-6/h2-11H,12H2,1H3;1-5H,7H2 |
| InChIKey | GERQZCWZGKLMCQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;N-benzyl-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;N-benzyl-N-methylaniline?
The IUPAC name of aniline;N-benzyl-N-methylaniline (CID 163577424) is aniline;N-benzyl-N-methylaniline.
What is the SMILES notation for aniline;N-benzyl-N-methylaniline?
The canonical SMILES for aniline;N-benzyl-N-methylaniline is CN(Cc1ccccc1)c1ccccc1.Nc1ccccc1.
What is the InChIKey of aniline;N-benzyl-N-methylaniline?
The InChIKey is GERQZCWZGKLMCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N.C6H7N/c1-15(14-10-6-3-7-11-14)12-13-8-4-2-5-9-13;7-6-4-2-1-3-5-6/h2-11H,12H2,1H3;1-5H,7H2.
What are the key properties of aniline;N-benzyl-N-methylaniline?
aniline;N-benzyl-N-methylaniline has a molecular weight of 290.41 g/mol, XLogP of 4.59, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;N-benzyl-N-methylaniline is sourced from PubChem (CID 163577424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).