About 3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine
3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine (PubChem CID 60875163) has the molecular formula C14H15FN2
and a molecular weight of 230.29 g/mol. Its IUPAC name is 3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine |
| PubChem CID | 60875163 |
| Molecular Formula | C14H15FN2 |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine |
| SMILES | CN(Cc1ccccc1)c1cc(N)cc(F)c1 |
| InChI | InChI=1S/C14H15FN2/c1-17(10-11-5-3-2-4-6-11)14-8-12(15)7-13(16)9-14/h2-9H,10,16H2,1H3 |
| InChIKey | HSZKOYWFPZSJHJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine?
The IUPAC name of 3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine (CID 60875163) is 3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine.
What is the SMILES notation for 3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine?
The canonical SMILES for 3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine is CN(Cc1ccccc1)c1cc(N)cc(F)c1.
What is the InChIKey of 3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine?
The InChIKey is HSZKOYWFPZSJHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15FN2/c1-17(10-11-5-3-2-4-6-11)14-8-12(15)7-13(16)9-14/h2-9H,10,16H2,1H3.
What are the key properties of 3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine?
3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine has a molecular weight of 230.29 g/mol, XLogP of 3.04, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-benzyl-5-fluoro-3-N-methylbenzene-1,3-diamine is sourced from PubChem (CID 60875163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).