About 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione
2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione (PubChem CID 8855141) has the molecular formula C22H18N2O2
and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione.
Molecular Properties
| Compound Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione |
| PubChem CID | 8855141 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1C=C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H18N2O2/c1-14-19(15(2)24(23-14)13-16-8-4-3-5-9-16)12-20-21(25)17-10-6-7-11-18(17)22(20)26/h3-12H,13H2,1-2H3 |
| InChIKey | FWYMLSMIYXDBKB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione?
The IUPAC name of 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione (CID 8855141) is 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione.
What is the SMILES notation for 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione?
The canonical SMILES for 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione is Cc1nn(Cc2ccccc2)c(C)c1C=C1C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione?
The InChIKey is FWYMLSMIYXDBKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O2/c1-14-19(15(2)24(23-14)13-16-8-4-3-5-9-16)12-20-21(25)17-10-6-7-11-18(17)22(20)26/h3-12H,13H2,1-2H3.
What are the key properties of 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione?
2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione has a molecular weight of 342.40 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione is sourced from PubChem (CID 8855141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).