C22H18N2O2 — CID 8855141
2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione (PubChem CID 8855141) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione.
| Compound Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 8855141 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]indene-1,3-dione |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1C=C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H18N2O2/c1-14-19(15(2)24(23-14)13-16-8-4-3-5-9-16)12-20-21(25)17-10-6-7-11-18(17)22(20)26/h3-12H,13H2,1-2H3 |
| InChIKey | FWYMLSMIYXDBKB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|