C18H18ClN3O2S — CID 22202405
N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chlorobenzenesulfonamide (PubChem CID 22202405) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chlorobenzenesulfonamide.
| Compound Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 22202405 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-chlorobenzenesulfonamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClN3O2S/c1-13-18(21-25(23,24)17-10-8-16(19)9-11-17)14(2)22(20-13)12-15-6-4-3-5-7-15/h3-11,21H,12H2,1-2H3 |
| InChIKey | BMFQCYBREMAYEM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |