C20H23N3O4S — CID 22202423
N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3,4-dimethoxybenzenesulfonamide (PubChem CID 22202423) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 22202423 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2c(C)nn(Cc3ccccc3)c2C)cc1OC |
| InChI | InChI=1S/C20H23N3O4S/c1-14-20(15(2)23(21-14)13-16-8-6-5-7-9-16)22-28(24,25)17-10-11-18(26-3)19(12-17)27-4/h5-12,22H,13H2,1-4H3 |
| InChIKey | PIZUWTKJOLPBFB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |