C16H23N3O2S — CID 22202442
N-(1-benzyl-3,5-dimethylpyrazol-4-yl)butane-1-sulfonamide (PubChem CID 22202442) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is N-(1-benzyl-3,5-dimethylpyrazol-4-yl)butane-1-sulfonamide.
| Compound Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 22202442 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)Nc1c(C)nn(Cc2ccccc2)c1C |
| InChI | InChI=1S/C16H23N3O2S/c1-4-5-11-22(20,21)18-16-13(2)17-19(14(16)3)12-15-9-7-6-8-10-15/h6-10,18H,4-5,11-12H2,1-3H3 |
| InChIKey | CWRHEENCPCXRLE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |