C20H17N3O3 — CID 8851506
(4Z)-4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one (PubChem CID 8851506) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is (4Z)-4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 8851506 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (4Z)-4-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]-2-(furan-2-yl)-1,3-oxazol-5-one |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1/C=C1\N=C(c2ccco2)OC1=O |
| InChI | InChI=1S/C20H17N3O3/c1-13-16(14(2)23(22-13)12-15-7-4-3-5-8-15)11-17-20(24)26-19(21-17)18-9-6-10-25-18/h3-11H,12H2,1-2H3/b17-11- |
| InChIKey | RGQWXDPRFDYLRD-BOPFTXTBSA-N |
| XLogP | 3.49 |
| TPSA | 69.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|