C20H21N5O3 — CID 9352922
N'-[(Z)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-N-(furan-2-ylmethyl)oxamide (PubChem CID 9352922) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is N'-[(Z)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 9352922 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N'-[(Z)-(1-benzyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-N-(furan-2-ylmethyl)oxamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1/C=N\NC(=O)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C20H21N5O3/c1-14-18(15(2)25(24-14)13-16-7-4-3-5-8-16)12-22-23-20(27)19(26)21-11-17-9-6-10-28-17/h3-10,12H,11,13H2,1-2H3,(H,21,26)(H,23,27)/b22-12- |
| InChIKey | RRZAMZIFHHNMAB-UUYOSTAYSA-N |
| XLogP | 1.91 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|