C18H15Cl2N5O3 — CID 27686221
N'-[(Z)-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-N-(furan-2-ylmethyl)oxamide (PubChem CID 27686221) has the molecular formula C18H15Cl2N5O3 and a molecular weight of 420.26 g/mol. Its IUPAC name is N'-[(Z)-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-N-(furan-2-ylmethyl)oxamide.
| Compound Name | N'-[(Z)-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-N-(furan-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 27686221 |
| Molecular Formula | C18H15Cl2N5O3 |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | N'-[(Z)-[5-chloro-1-(3-chlorophenyl)-3-methylpyrazol-4-yl]methylideneamino]-N-(furan-2-ylmethyl)oxamide |
| SMILES | Cc1nn(-c2cccc(Cl)c2)c(Cl)c1/C=N\NC(=O)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C18H15Cl2N5O3/c1-11-15(16(20)25(24-11)13-5-2-4-12(19)8-13)10-22-23-18(27)17(26)21-9-14-6-3-7-28-14/h2-8,10H,9H2,1H3,(H,21,26)(H,23,27)/b22-10- |
| InChIKey | DMCYXCHIGCPJLB-YVNNLAQVSA-N |
| XLogP | 2.85 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|