C15H16ClN5O2 — CID 9120759
N'-[(Z)-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylideneamino]oxamide (PubChem CID 9120759) has the molecular formula C15H16ClN5O2 and a molecular weight of 333.78 g/mol. Its IUPAC name is N'-[(Z)-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylideneamino]oxamide.
| Compound Name | N'-[(Z)-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 9120759 |
| Molecular Formula | C15H16ClN5O2 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N'-[(Z)-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylideneamino]oxamide |
| SMILES | Cc1nn(Cc2ccccc2Cl)c(C)c1/C=N\NC(=O)C(N)=O |
| InChI | InChI=1S/C15H16ClN5O2/c1-9-12(7-18-19-15(23)14(17)22)10(2)21(20-9)8-11-5-3-4-6-13(11)16/h3-7H,8H2,1-2H3,(H2,17,22)(H,19,23)/b18-7- |
| InChIKey | QXLSDPMICMDTCA-WSVATBPTSA-N |
| XLogP | 1.14 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|