C20H21ClN4 — CID 9059269
N-[(Z)-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-4-methylaniline (PubChem CID 9059269) has the molecular formula C20H21ClN4 and a molecular weight of 352.87 g/mol. Its IUPAC name is N-[(Z)-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-4-methylaniline.
| Compound Name | N-[(Z)-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-4-methylaniline |
|---|---|
| PubChem CID | 9059269 |
| Molecular Formula | C20H21ClN4 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-[(Z)-[1-[(2-chlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methylideneamino]-4-methylaniline |
| SMILES | Cc1ccc(N/N=C\c2c(C)nn(Cc3ccccc3Cl)c2C)cc1 |
| InChI | InChI=1S/C20H21ClN4/c1-14-8-10-18(11-9-14)23-22-12-19-15(2)24-25(16(19)3)13-17-6-4-5-7-20(17)21/h4-12,23H,13H2,1-3H3/b22-12- |
| InChIKey | ANYWYKIGPDTFEV-UUYOSTAYSA-N |
| XLogP | 4.96 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|