C18H17ClN4 — CID 7301273
N-[(E)-[5-chloro-3-methyl-1-(4-methylphenyl)pyrazol-4-yl]methylideneamino]aniline (PubChem CID 7301273) has the molecular formula C18H17ClN4 and a molecular weight of 324.82 g/mol. Its IUPAC name is N-[(E)-[5-chloro-3-methyl-1-(4-methylphenyl)pyrazol-4-yl]methylideneamino]aniline.
| Compound Name | N-[(E)-[5-chloro-3-methyl-1-(4-methylphenyl)pyrazol-4-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 7301273 |
| Molecular Formula | C18H17ClN4 |
| Molecular Weight | 324.82 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-[(E)-[5-chloro-3-methyl-1-(4-methylphenyl)pyrazol-4-yl]methylideneamino]aniline |
| SMILES | Cc1ccc(-n2nc(C)c(/C=N/Nc3ccccc3)c2Cl)cc1 |
| InChI | InChI=1S/C18H17ClN4/c1-13-8-10-16(11-9-13)23-18(19)17(14(2)22-23)12-20-21-15-6-4-3-5-7-15/h3-12,21H,1-2H3/b20-12+ |
| InChIKey | JBSIIVPHFYVHGM-UDWIEESQSA-N |
| XLogP | 4.59 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.82 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|