C18H15ClN6 — CID 4573901
N-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-benzimidazol-2-amine (PubChem CID 4573901) has the molecular formula C18H15ClN6 and a molecular weight of 350.81 g/mol. Its IUPAC name is N-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 4573901 |
| Molecular Formula | C18H15ClN6 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1H-benzimidazol-2-amine |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C=NNc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H15ClN6/c1-12-14(17(19)25(24-12)13-7-3-2-4-8-13)11-20-23-18-21-15-9-5-6-10-16(15)22-18/h2-11H,1H3,(H2,21,22,23) |
| InChIKey | OQWAQMALOHTZJT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|