C15H14N4 — CID 14088787
N-[(E)-(4-methylphenyl)methylideneamino]-1H-benzimidazol-2-amine (PubChem CID 14088787) has the molecular formula C15H14N4 and a molecular weight of 250.31 g/mol. Its IUPAC name is N-[(E)-(4-methylphenyl)methylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(E)-(4-methylphenyl)methylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 14088787 |
| Molecular Formula | C15H14N4 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | N-[(E)-(4-methylphenyl)methylideneamino]-1H-benzimidazol-2-amine |
| SMILES | Cc1ccc(/C=N/Nc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C15H14N4/c1-11-6-8-12(9-7-11)10-16-19-15-17-13-4-2-3-5-14(13)18-15/h2-10H,1H3,(H2,17,18,19)/b16-10+ |
| InChIKey | JTZYFQRPRRURDD-MHWRWJLKSA-N |
| XLogP | 3.32 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|