C14H12N4O2 — CID 3134920
4-[(1H-benzimidazol-2-ylhydrazinylidene)methyl]benzene-1,3-diol (PubChem CID 3134920) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 4-[(1H-benzimidazol-2-ylhydrazinylidene)methyl]benzene-1,3-diol.
| Compound Name | 4-[(1H-benzimidazol-2-ylhydrazinylidene)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 3134920 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-[(1H-benzimidazol-2-ylhydrazinylidene)methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(C=NNc2nc3ccccc3[nH]2)c(O)c1 |
| InChI | InChI=1S/C14H12N4O2/c19-10-6-5-9(13(20)7-10)8-15-18-14-16-11-3-1-2-4-12(11)17-14/h1-8,19-20H,(H2,16,17,18) |
| InChIKey | CBZCKXFXCIWKBO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|