C21H17ClN4O — CID 21370286
N-[(E)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-1H-benzimidazol-2-amine (PubChem CID 21370286) has the molecular formula C21H17ClN4O and a molecular weight of 376.85 g/mol. Its IUPAC name is N-[(E)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(E)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 21370286 |
| Molecular Formula | C21H17ClN4O |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-[(E)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-1H-benzimidazol-2-amine |
| SMILES | Clc1ccccc1COc1ccccc1/C=N/Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H17ClN4O/c22-17-9-3-1-8-16(17)14-27-20-12-6-2-7-15(20)13-23-26-21-24-18-10-4-5-11-19(18)25-21/h1-13H,14H2,(H2,24,25,26)/b23-13+ |
| InChIKey | ZTUZFAHVPJKUOP-YDZHTSKRSA-N |
| XLogP | 5.24 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|