C21H17ClN4 — CID 3669791
N-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]naphthalen-2-amine (PubChem CID 3669791) has the molecular formula C21H17ClN4 and a molecular weight of 360.85 g/mol. Its IUPAC name is N-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]naphthalen-2-amine.
| Compound Name | N-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]naphthalen-2-amine |
|---|---|
| PubChem CID | 3669791 |
| Molecular Formula | C21H17ClN4 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]naphthalen-2-amine |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1C=NNc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H17ClN4/c1-15-20(21(22)26(25-15)19-9-3-2-4-10-19)14-23-24-18-12-11-16-7-5-6-8-17(16)13-18/h2-14,24H,1H3 |
| InChIKey | NYHLAZFBZYQBCL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|