C24H19FN6O — CID 6155597
N-[(Z)-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]-1H-benzimidazol-2-amine (PubChem CID 6155597) has the molecular formula C24H19FN6O and a molecular weight of 426.46 g/mol. Its IUPAC name is N-[(Z)-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[(Z)-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 6155597 |
| Molecular Formula | C24H19FN6O |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | N-[(Z)-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]-1H-benzimidazol-2-amine |
| SMILES | Cc1nn(-c2ccccc2)c(Oc2ccc(F)cc2)c1/C=N\Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H19FN6O/c1-16-20(15-26-29-24-27-21-9-5-6-10-22(21)28-24)23(32-19-13-11-17(25)12-14-19)31(30-16)18-7-3-2-4-8-18/h2-15H,1H3,(H2,27,28,29)/b26-15- |
| InChIKey | RZGOUQKUKHSENN-YSMPRRRNSA-N |
| XLogP | 5.43 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|