C19H15FN6O — CID 2368370
1-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 2368370) has the molecular formula C19H15FN6O and a molecular weight of 362.37 g/mol. Its IUPAC name is 1-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 2368370 |
| Molecular Formula | C19H15FN6O |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Cc1nn(-c2ccccc2)c(Oc2ccc(F)cc2)c1C=Nn1cnnc1 |
| InChI | InChI=1S/C19H15FN6O/c1-14-18(11-23-25-12-21-22-13-25)19(27-17-9-7-15(20)8-10-17)26(24-14)16-5-3-2-4-6-16/h2-13H,1H3 |
| InChIKey | ZAYNKEIXRGPTGM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|