C26H31N5O2S — CID 2437296
1-cyclohexyl-3-[[5-(4-ethoxyphenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]thiourea (PubChem CID 2437296) has the molecular formula C26H31N5O2S and a molecular weight of 477.63 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[5-(4-ethoxyphenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]thiourea.
| Compound Name | 1-cyclohexyl-3-[[5-(4-ethoxyphenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 2437296 |
| Molecular Formula | C26H31N5O2S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 1-cyclohexyl-3-[[5-(4-ethoxyphenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]thiourea |
| SMILES | CCOc1ccc(Oc2c(C=NNC(=S)NC3CCCCC3)c(C)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H31N5O2S/c1-3-32-22-14-16-23(17-15-22)33-25-24(19(2)30-31(25)21-12-8-5-9-13-21)18-27-29-26(34)28-20-10-6-4-7-11-20/h5,8-9,12-18,20H,3-4,6-7,10-11H2,1-2H3,(H2,28,29,34) |
| InChIKey | XYPDRJIUTZXXPJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|