C26H24FN5O3 — CID 6893267
N-[(E)-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]-2-(2-methoxyanilino)acetamide (PubChem CID 6893267) has the molecular formula C26H24FN5O3 and a molecular weight of 473.51 g/mol. Its IUPAC name is N-[(E)-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]-2-(2-methoxyanilino)acetamide.
| Compound Name | N-[(E)-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]-2-(2-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 6893267 |
| Molecular Formula | C26H24FN5O3 |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-[(E)-[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylideneamino]-2-(2-methoxyanilino)acetamide |
| SMILES | COc1ccccc1NCC(=O)N/N=C/c1c(C)nn(-c2ccccc2)c1Oc1ccc(F)cc1 |
| InChI | InChI=1S/C26H24FN5O3/c1-18-22(16-29-30-25(33)17-28-23-10-6-7-11-24(23)34-2)26(35-21-14-12-19(27)13-15-21)32(31-18)20-8-4-3-5-9-20/h3-16,28H,17H2,1-2H3,(H,30,33)/b29-16+ |
| InChIKey | MDRDQNXUFRUUTN-MUFRIFMGSA-N |
| XLogP | 4.68 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|