C17H19N3O3 — CID 6910807
2-(2-methoxyanilino)-N-[(E)-(4-methoxyphenyl)methylideneamino]acetamide (PubChem CID 6910807) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-N-[(E)-(4-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-methoxyanilino)-N-[(E)-(4-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6910807 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-(2-methoxyanilino)-N-[(E)-(4-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N/NC(=O)CNc2ccccc2OC)cc1 |
| InChI | InChI=1S/C17H19N3O3/c1-22-14-9-7-13(8-10-14)11-19-20-17(21)12-18-15-5-3-4-6-16(15)23-2/h3-11,18H,12H2,1-2H3,(H,20,21)/b19-11+ |
| InChIKey | DPACHJBZYVMVRE-YBFXNURJSA-N |
| XLogP | 2.27 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|