C15H16N4O2 — CID 717684
2-(2-methoxyanilino)-N-(pyridin-3-ylmethylideneamino)acetamide (PubChem CID 717684) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-(2-methoxyanilino)-N-(pyridin-3-ylmethylideneamino)acetamide.
| Compound Name | 2-(2-methoxyanilino)-N-(pyridin-3-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 717684 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(2-methoxyanilino)-N-(pyridin-3-ylmethylideneamino)acetamide |
| SMILES | COc1ccccc1NCC(=O)NN=Cc1cccnc1 |
| InChI | InChI=1S/C15H16N4O2/c1-21-14-7-3-2-6-13(14)17-11-15(20)19-18-10-12-5-4-8-16-9-12/h2-10,17H,11H2,1H3,(H,19,20) |
| InChIKey | ZZXGKSAGOALFNW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|