C20H23N3O6 — CID 7933428
[2,6-dimethoxy-4-[(Z)-[[2-(2-methoxyanilino)acetyl]hydrazinylidene]methyl]phenyl] acetate (PubChem CID 7933428) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(Z)-[[2-(2-methoxyanilino)acetyl]hydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [2,6-dimethoxy-4-[(Z)-[[2-(2-methoxyanilino)acetyl]hydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 7933428 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | [2,6-dimethoxy-4-[(Z)-[[2-(2-methoxyanilino)acetyl]hydrazinylidene]methyl]phenyl] acetate |
| SMILES | COc1ccccc1NCC(=O)N/N=C\c1cc(OC)c(OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C20H23N3O6/c1-13(24)29-20-17(27-3)9-14(10-18(20)28-4)11-22-23-19(25)12-21-15-7-5-6-8-16(15)26-2/h5-11,21H,12H2,1-4H3,(H,23,25)/b22-11- |
| InChIKey | FDYLEPZHHHLWBO-JJFYIABZSA-N |
| XLogP | 2.20 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|