C23H20FN3O4 — CID 1118922
[4-[[[2-(2-methoxyanilino)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate (PubChem CID 1118922) has the molecular formula C23H20FN3O4 and a molecular weight of 421.43 g/mol. Its IUPAC name is [4-[[[2-(2-methoxyanilino)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate.
| Compound Name | [4-[[[2-(2-methoxyanilino)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 1118922 |
| Molecular Formula | C23H20FN3O4 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [4-[[[2-(2-methoxyanilino)acetyl]hydrazinylidene]methyl]phenyl] 3-fluorobenzoate |
| SMILES | COc1ccccc1NCC(=O)NN=Cc1ccc(OC(=O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C23H20FN3O4/c1-30-21-8-3-2-7-20(21)25-15-22(28)27-26-14-16-9-11-19(12-10-16)31-23(29)17-5-4-6-18(24)13-17/h2-14,25H,15H2,1H3,(H,27,28) |
| InChIKey | WGJLJQYEGFYFJZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|