C26H24FN3O4S2 — CID 71575605
(2S)-2-[(5Z)-5-[[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid (PubChem CID 71575605) has the molecular formula C26H24FN3O4S2 and a molecular weight of 525.63 g/mol. Its IUPAC name is (2S)-2-[(5Z)-5-[[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid.
| Compound Name | (2S)-2-[(5Z)-5-[[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 71575605 |
| Molecular Formula | C26H24FN3O4S2 |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | (2S)-2-[(5Z)-5-[[5-(4-fluorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid |
| SMILES | CCC(C)[C@@H](C(=O)O)N1C(=O)/C(=C/c2c(C)nn(-c3ccccc3)c2Oc2ccc(F)cc2)SC1=S |
| InChI | InChI=1S/C26H24FN3O4S2/c1-4-15(2)22(25(32)33)29-23(31)21(36-26(29)35)14-20-16(3)28-30(18-8-6-5-7-9-18)24(20)34-19-12-10-17(27)11-13-19/h5-15,22H,4H2,1-3H3,(H,32,33)/b21-14-/t15?,22-/m0/s1 |
| InChIKey | IEPOGYRIZIJSSB-YEQYKJMHSA-N |
| XLogP | 5.81 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|