C30H25N3O4S2 — CID 71452451
(2S)-2-[(5Z)-5-[[3-methyl-5-(4-methylphenoxy)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid (PubChem CID 71452451) has the molecular formula C30H25N3O4S2 and a molecular weight of 555.68 g/mol. Its IUPAC name is (2S)-2-[(5Z)-5-[[3-methyl-5-(4-methylphenoxy)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(5Z)-5-[[3-methyl-5-(4-methylphenoxy)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 71452451 |
| Molecular Formula | C30H25N3O4S2 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | (2S)-2-[(5Z)-5-[[3-methyl-5-(4-methylphenoxy)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
| SMILES | Cc1ccc(Oc2c(/C=C3\SC(=S)N([C@@H](Cc4ccccc4)C(=O)O)C3=O)c(C)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H25N3O4S2/c1-19-13-15-23(16-14-19)37-28-24(20(2)31-33(28)22-11-7-4-8-12-22)18-26-27(34)32(30(38)39-26)25(29(35)36)17-21-9-5-3-6-10-21/h3-16,18,25H,17H2,1-2H3,(H,35,36)/b26-18-/t25-/m0/s1 |
| InChIKey | CLEMWKFTNIXQND-BIAHXVBSSA-N |
| XLogP | 6.18 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|