C32H23F3N4O4S2 — CID 71450563
(2S)-3-(1H-indol-3-yl)-2-[(5Z)-5-[[3-methyl-1-phenyl-5-[3-(trifluoromethyl)phenoxy]pyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 71450563) has the molecular formula C32H23F3N4O4S2 and a molecular weight of 648.69 g/mol. Its IUPAC name is (2S)-3-(1H-indol-3-yl)-2-[(5Z)-5-[[3-methyl-1-phenyl-5-[3-(trifluoromethyl)phenoxy]pyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | (2S)-3-(1H-indol-3-yl)-2-[(5Z)-5-[[3-methyl-1-phenyl-5-[3-(trifluoromethyl)phenoxy]pyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 71450563 |
| Molecular Formula | C32H23F3N4O4S2 |
| Molecular Weight | 648.69 g/mol |
| Exact Mass | 648.11 |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-2-[(5Z)-5-[[3-methyl-1-phenyl-5-[3-(trifluoromethyl)phenoxy]pyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | Cc1nn(-c2ccccc2)c(Oc2cccc(C(F)(F)F)c2)c1/C=C1\SC(=S)N([C@@H](Cc2c[nH]c3ccccc23)C(=O)O)C1=O |
| InChI | InChI=1S/C32H23F3N4O4S2/c1-18-24(29(39(37-18)21-9-3-2-4-10-21)43-22-11-7-8-20(15-22)32(33,34)35)16-27-28(40)38(31(44)45-27)26(30(41)42)14-19-17-36-25-13-6-5-12-23(19)25/h2-13,15-17,26,36H,14H2,1H3,(H,41,42)/b27-16-/t26-/m0/s1 |
| InChIKey | YLIFDUORCLAEGS-AHXGIVOUSA-N |
| XLogP | 7.37 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.69 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|