C27H27N3O4S2 — CID 71575712
(2S)-3-methyl-2-[(5Z)-5-[[3-methyl-5-(4-methylphenoxy)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid (PubChem CID 71575712) has the molecular formula C27H27N3O4S2 and a molecular weight of 521.66 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(5Z)-5-[[3-methyl-5-(4-methylphenoxy)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid.
| Compound Name | (2S)-3-methyl-2-[(5Z)-5-[[3-methyl-5-(4-methylphenoxy)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 71575712 |
| Molecular Formula | C27H27N3O4S2 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | (2S)-3-methyl-2-[(5Z)-5-[[3-methyl-5-(4-methylphenoxy)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid |
| SMILES | CCC(C)[C@@H](C(=O)O)N1C(=O)/C(=C/c2c(C)nn(-c3ccccc3)c2Oc2ccc(C)cc2)SC1=S |
| InChI | InChI=1S/C27H27N3O4S2/c1-5-17(3)23(26(32)33)29-24(31)22(36-27(29)35)15-21-18(4)28-30(19-9-7-6-8-10-19)25(21)34-20-13-11-16(2)12-14-20/h6-15,17,23H,5H2,1-4H3,(H,32,33)/b22-15-/t17?,23-/m0/s1 |
| InChIKey | AZPCDVMDPGKBMG-USDVNPRBSA-N |
| XLogP | 5.98 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|