C33H24ClN3O4S3 — CID 118728681
(2S)-N-(benzenesulfonyl)-2-[(5Z)-5-[[4-(4-chlorophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(1H-indol-3-yl)propanamide (PubChem CID 118728681) has the molecular formula C33H24ClN3O4S3 and a molecular weight of 658.23 g/mol. Its IUPAC name is (2S)-N-(benzenesulfonyl)-2-[(5Z)-5-[[4-(4-chlorophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(1H-indol-3-yl)propanamide.
| Compound Name | (2S)-N-(benzenesulfonyl)-2-[(5Z)-5-[[4-(4-chlorophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 118728681 |
| Molecular Formula | C33H24ClN3O4S3 |
| Molecular Weight | 658.23 g/mol |
| Exact Mass | 657.06 |
| IUPAC Name | (2S)-N-(benzenesulfonyl)-2-[(5Z)-5-[[4-(4-chlorophenyl)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(1H-indol-3-yl)propanamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)[C@H](Cc1c[nH]c2ccccc12)N1C(=O)/C(=C/c2ccc(-c3ccc(Cl)cc3)cc2)SC1=S |
| InChI | InChI=1S/C33H24ClN3O4S3/c34-25-16-14-23(15-17-25)22-12-10-21(11-13-22)18-30-32(39)37(33(42)43-30)29(19-24-20-35-28-9-5-4-8-27(24)28)31(38)36-44(40,41)26-6-2-1-3-7-26/h1-18,20,29,35H,19H2,(H,36,38)/b30-18-/t29-/m0/s1 |
| InChIKey | BJRJXKGVHIMLKX-MNRBYUMSSA-N |
| XLogP | 6.81 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.23 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|