C29H32N2O4S2 — CID 85042104
2-[5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 85042104) has the molecular formula C29H32N2O4S2 and a molecular weight of 536.72 g/mol. Its IUPAC name is 2-[5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 85042104 |
| Molecular Formula | C29H32N2O4S2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 2-[5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)(C)c1cc(C=C2SC(=S)N(C(Cc3c[nH]c4ccccc34)C(=O)O)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C29H32N2O4S2/c1-28(2,3)19-11-16(12-20(24(19)32)29(4,5)6)13-23-25(33)31(27(36)37-23)22(26(34)35)14-17-15-30-21-10-8-7-9-18(17)21/h7-13,15,22,30,32H,14H2,1-6H3,(H,34,35) |
| InChIKey | GTSZKNXDYIXJSI-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|