C29H21FN2O5S2 — CID 66571891
(2S)-2-[(5Z)-5-[[4-[2-(2-fluorophenyl)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 66571891) has the molecular formula C29H21FN2O5S2 and a molecular weight of 560.63 g/mol. Its IUPAC name is (2S)-2-[(5Z)-5-[[4-[2-(2-fluorophenyl)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[(5Z)-5-[[4-[2-(2-fluorophenyl)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 66571891 |
| Molecular Formula | C29H21FN2O5S2 |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | (2S)-2-[(5Z)-5-[[4-[2-(2-fluorophenyl)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(COc1ccc(/C=C2\SC(=S)N([C@@H](Cc3c[nH]c4ccccc34)C(=O)O)C2=O)cc1)c1ccccc1F |
| InChI | InChI=1S/C29H21FN2O5S2/c30-22-7-3-1-6-21(22)25(33)16-37-19-11-9-17(10-12-19)13-26-27(34)32(29(38)39-26)24(28(35)36)14-18-15-31-23-8-4-2-5-20(18)23/h1-13,15,24,31H,14,16H2,(H,35,36)/b26-13-/t24-/m0/s1 |
| InChIKey | DBEZHEVLXHBGQF-UYNKWATKSA-N |
| XLogP | 5.47 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|