C33H26ClN3O6S2 — CID 166522354
(2S)-N-(4-chlorophenyl)sulfonyl-2-[[2-[2,4-dioxo-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]-3-phenylpropanamide (PubChem CID 166522354) has the molecular formula C33H26ClN3O6S2 and a molecular weight of 660.17 g/mol. Its IUPAC name is (2S)-N-(4-chlorophenyl)sulfonyl-2-[[2-[2,4-dioxo-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-(4-chlorophenyl)sulfonyl-2-[[2-[2,4-dioxo-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 166522354 |
| Molecular Formula | C33H26ClN3O6S2 |
| Molecular Weight | 660.17 g/mol |
| Exact Mass | 659.10 |
| IUPAC Name | (2S)-N-(4-chlorophenyl)sulfonyl-2-[[2-[2,4-dioxo-5-[(4-phenylphenyl)methylidene]-1,3-thiazolidin-3-yl]acetyl]amino]-3-phenylpropanamide |
| SMILES | O=C(CN1C(=O)SC(=Cc2ccc(-c3ccccc3)cc2)C1=O)N[C@@H](Cc1ccccc1)C(=O)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H26ClN3O6S2/c34-26-15-17-27(18-16-26)45(42,43)36-31(39)28(19-22-7-3-1-4-8-22)35-30(38)21-37-32(40)29(44-33(37)41)20-23-11-13-25(14-12-23)24-9-5-2-6-10-24/h1-18,20,28H,19,21H2,(H,35,38)(H,36,39)/t28-/m0/s1 |
| InChIKey | HMDLWRZQYMVNBY-NDEPHWFRSA-N |
| XLogP | 5.28 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.17 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|