C21H18N2O4S2 — CID 40851386
(2R)-2-[[2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 40851386) has the molecular formula C21H18N2O4S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is (2R)-2-[[2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 40851386 |
| Molecular Formula | C21H18N2O4S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | (2R)-2-[[2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(CN1C(=O)/C(=C/c2ccccc2)SC1=S)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H18N2O4S2/c24-18(22-16(20(26)27)11-14-7-3-1-4-8-14)13-23-19(25)17(29-21(23)28)12-15-9-5-2-6-10-15/h1-10,12,16H,11,13H2,(H,22,24)(H,26,27)/b17-12-/t16-/m1/s1 |
| InChIKey | VXRXBYJEWCWSOE-WISAJEAXSA-N |
| XLogP | 2.70 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|