C17H17N2O4S3- — CID 7657382
(2S)-2-[[2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4-methylsulfanylbutanoate (PubChem CID 7657382) has the molecular formula C17H17N2O4S3- and a molecular weight of 409.53 g/mol. Its IUPAC name is (2S)-2-[[2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[[2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7657382 |
| Molecular Formula | C17H17N2O4S3- |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | (2S)-2-[[2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)CN1C(=O)/C(=C/c2ccccc2)SC1=S)C(=O)[O-] |
| InChI | InChI=1S/C17H18N2O4S3/c1-25-8-7-12(16(22)23)18-14(20)10-19-15(21)13(26-17(19)24)9-11-5-3-2-4-6-11/h2-6,9,12H,7-8,10H2,1H3,(H,18,20)(H,22,23)/p-1/b13-9-/t12-/m0/s1 |
| InChIKey | NTUDLEKDOZQKCL-VWLVURMCSA-M |
| XLogP | 0.88 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|