C17H18N2O4S3 — CID 4763043
2-[[2-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 4763043) has the molecular formula C17H18N2O4S3 and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-[[2-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 4763043 |
| Molecular Formula | C17H18N2O4S3 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 2-[[2-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)CN1C(=O)C(=Cc2ccccc2)SC1=S)C(=O)O |
| InChI | InChI=1S/C17H18N2O4S3/c1-25-8-7-12(16(22)23)18-14(20)10-19-15(21)13(26-17(19)24)9-11-5-3-2-4-6-11/h2-6,9,12H,7-8,10H2,1H3,(H,18,20)(H,22,23) |
| InChIKey | NTUDLEKDOZQKCL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|