C18H20N2O4S3 — CID 40851397
(2S)-2-[3-[(5E)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 40851397) has the molecular formula C18H20N2O4S3 and a molecular weight of 424.57 g/mol. Its IUPAC name is (2S)-2-[3-[(5E)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[3-[(5E)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 40851397 |
| Molecular Formula | C18H20N2O4S3 |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | (2S)-2-[3-[(5E)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)CCN1C(=O)/C(=C\c2ccccc2)SC1=S)C(=O)O |
| InChI | InChI=1S/C18H20N2O4S3/c1-26-10-8-13(17(23)24)19-15(21)7-9-20-16(22)14(27-18(20)25)11-12-5-3-2-4-6-12/h2-6,11,13H,7-10H2,1H3,(H,19,21)(H,23,24)/b14-11+/t13-/m0/s1 |
| InChIKey | KARHBHUZLYIZQU-UQRISPGASA-N |
| XLogP | 2.60 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|