C17H17N3O5S2 — CID 7657389
(2S)-5-amino-2-[[2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-5-oxopentanoic acid (PubChem CID 7657389) has the molecular formula C17H17N3O5S2 and a molecular weight of 407.47 g/mol. Its IUPAC name is (2S)-5-amino-2-[[2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 7657389 |
| Molecular Formula | C17H17N3O5S2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | (2S)-5-amino-2-[[2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)CN1C(=O)/C(=C/c2ccccc2)SC1=S)C(=O)O |
| InChI | InChI=1S/C17H17N3O5S2/c18-13(21)7-6-11(16(24)25)19-14(22)9-20-15(23)12(27-17(20)26)8-10-4-2-1-3-5-10/h1-5,8,11H,6-7,9H2,(H2,18,21)(H,19,22)(H,24,25)/b12-8-/t11-/m0/s1 |
| InChIKey | SHPDEZPSKAKCRH-LCFDYFRESA-N |
| XLogP | 0.72 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|