C17H16N3O5S2- — CID 7657501
(2R)-4-amino-2-[[2-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4-oxobutanoate (PubChem CID 7657501) has the molecular formula C17H16N3O5S2- and a molecular weight of 406.47 g/mol. Its IUPAC name is (2R)-4-amino-2-[[2-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4-oxobutanoate.
| Compound Name | (2R)-4-amino-2-[[2-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 7657501 |
| Molecular Formula | C17H16N3O5S2- |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (2R)-4-amino-2-[[2-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]-4-oxobutanoate |
| SMILES | Cc1ccc(/C=C2/SC(=S)N(CC(=O)N[C@H](CC(N)=O)C(=O)[O-])C2=O)cc1 |
| InChI | InChI=1S/C17H17N3O5S2/c1-9-2-4-10(5-3-9)6-12-15(23)20(17(26)27-12)8-14(22)19-11(16(24)25)7-13(18)21/h2-6,11H,7-8H2,1H3,(H2,18,21)(H,19,22)(H,24,25)/p-1/b12-6+/t11-/m1/s1 |
| InChIKey | SMXKKFZPIDXMGG-GGQLTLKSSA-M |
| XLogP | -0.69 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|