C27H23Cl2N3O5S2 — CID 98400953
2-[benzyl-(4-chlorophenyl)sulfonylamino]-N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide (PubChem CID 98400953) has the molecular formula C27H23Cl2N3O5S2 and a molecular weight of 604.54 g/mol. Its IUPAC name is 2-[benzyl-(4-chlorophenyl)sulfonylamino]-N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide.
| Compound Name | 2-[benzyl-(4-chlorophenyl)sulfonylamino]-N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 98400953 |
| Molecular Formula | C27H23Cl2N3O5S2 |
| Molecular Weight | 604.54 g/mol |
| Exact Mass | 603.05 |
| IUPAC Name | 2-[benzyl-(4-chlorophenyl)sulfonylamino]-N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]acetamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1ccc(Cl)cc1)NCCN1C(=O)S/C(=C/c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C27H23Cl2N3O5S2/c28-21-8-6-19(7-9-21)16-24-26(34)32(27(35)38-24)15-14-30-25(33)18-31(17-20-4-2-1-3-5-20)39(36,37)23-12-10-22(29)11-13-23/h1-13,16H,14-15,17-18H2,(H,30,33)/b24-16+ |
| InChIKey | QFMIDBVZNREWPN-LFVJCYFKSA-N |
| XLogP | 5.04 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|