C20H23ClN2O5S2 — CID 55755573
N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-cyclopentylsulfonylpropanamide (PubChem CID 55755573) has the molecular formula C20H23ClN2O5S2 and a molecular weight of 471.00 g/mol. Its IUPAC name is N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-cyclopentylsulfonylpropanamide.
| Compound Name | N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-cyclopentylsulfonylpropanamide |
|---|---|
| PubChem CID | 55755573 |
| Molecular Formula | C20H23ClN2O5S2 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | N-[2-[(5Z)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-cyclopentylsulfonylpropanamide |
| SMILES | O=C(CCS(=O)(=O)C1CCCC1)NCCN1C(=O)S/C(=C\c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C20H23ClN2O5S2/c21-15-7-5-14(6-8-15)13-17-19(25)23(20(26)29-17)11-10-22-18(24)9-12-30(27,28)16-3-1-2-4-16/h5-8,13,16H,1-4,9-12H2,(H,22,24)/b17-13- |
| InChIKey | UFKRBIJYVZXWST-LGMDPLHJSA-N |
| XLogP | 3.24 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|