C21H20ClN3O5S2 — CID 2122246
N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(dimethylsulfamoyl)benzamide (PubChem CID 2122246) has the molecular formula C21H20ClN3O5S2 and a molecular weight of 493.99 g/mol. Its IUPAC name is N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 2122246 |
| Molecular Formula | C21H20ClN3O5S2 |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | N-[2-[(5E)-5-[(4-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-3-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NCCN2C(=O)S/C(=C/c3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C21H20ClN3O5S2/c1-24(2)32(29,30)17-5-3-4-15(13-17)19(26)23-10-11-25-20(27)18(31-21(25)28)12-14-6-8-16(22)9-7-14/h3-9,12-13H,10-11H2,1-2H3,(H,23,26)/b18-12+ |
| InChIKey | AFOKVJWXELYCCK-LDADJPATSA-N |
| XLogP | 3.06 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|