C24H20N6O — CID 4221591
N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1H-benzimidazol-2-amine (PubChem CID 4221591) has the molecular formula C24H20N6O and a molecular weight of 408.47 g/mol. Its IUPAC name is N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1H-benzimidazol-2-amine.
| Compound Name | N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 4221591 |
| Molecular Formula | C24H20N6O |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1H-benzimidazol-2-amine |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C=NNc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C24H20N6O/c1-31-20-13-11-17(12-14-20)23-18(16-30(29-23)19-7-3-2-4-8-19)15-25-28-24-26-21-9-5-6-10-22(21)27-24/h2-16H,1H3,(H2,26,27,28) |
| InChIKey | JLYQMUORUPYYKN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|