C28H28N4O — CID 23966319
1-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-N-(4-piperidin-1-ylphenyl)methanimine (PubChem CID 23966319) has the molecular formula C28H28N4O and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-N-(4-piperidin-1-ylphenyl)methanimine.
| Compound Name | 1-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-N-(4-piperidin-1-ylphenyl)methanimine |
|---|---|
| PubChem CID | 23966319 |
| Molecular Formula | C28H28N4O |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 1-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-N-(4-piperidin-1-ylphenyl)methanimine |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=N/c2ccc(N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C28H28N4O/c1-33-27-16-10-22(11-17-27)28-23(21-32(30-28)26-8-4-2-5-9-26)20-29-24-12-14-25(15-13-24)31-18-6-3-7-19-31/h2,4-5,8-17,20-21H,3,6-7,18-19H2,1H3/b29-20+ |
| InChIKey | VGDCAZZEDSZTAX-ZTKZIYFRSA-N |
| XLogP | 6.29 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|