C30H24N4O — CID 2488828
N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,1-diphenylmethanimine (PubChem CID 2488828) has the molecular formula C30H24N4O and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,1-diphenylmethanimine.
| Compound Name | N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 2488828 |
| Molecular Formula | C30H24N4O |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,1-diphenylmethanimine |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C=NN=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24N4O/c1-35-28-19-17-25(18-20-28)30-26(22-34(33-30)27-15-9-4-10-16-27)21-31-32-29(23-11-5-2-6-12-23)24-13-7-3-8-14-24/h2-22H,1H3 |
| InChIKey | XMLSHGORDRILMW-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|